About (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane
(5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane (PubChem CID 130834779) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane |
| PubChem CID | 130834779 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane |
| SMILES | FC12C[C@@H]3CC(C[C@@H](C3)C1)N2 |
| InChI | InChI=1S/C9H14FN/c10-9-4-6-1-7(5-9)3-8(2-6)11-9/h6-8,11H,1-5H2/t6-,7+,8?,9? |
| InChIKey | XOIUMBHDDIZYQJ-QPIHLSAKSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane?
The IUPAC name of (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane (CID 130834779) is (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane?
The canonical SMILES for (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane is FC12C[C@@H]3CC(C[C@@H](C3)C1)N2.
What is the InChIKey of (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane?
The InChIKey is XOIUMBHDDIZYQJ-QPIHLSAKSA-N. The full InChI is InChI=1S/C9H14FN/c10-9-4-6-1-7(5-9)3-8(2-6)11-9/h6-8,11H,1-5H2/t6-,7+,8?,9?.
What are the key properties of (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane?
(5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane has a molecular weight of 155.22 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,7S)-1-fluoro-2-azatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 130834779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).