About (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine
(2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine (PubChem CID 130834810) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine.
Molecular Properties
| Compound Name | (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine |
| PubChem CID | 130834810 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine |
| SMILES | C=C1CCN(C[C@H](N)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2/c1-10-5-7-14(8-6-10)9-11(13)12(2,3)4/h11H,1,5-9,13H2,2-4H3/t11-/m0/s1 |
| InChIKey | WSSYZQUVBBTGHB-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine?
The IUPAC name of (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine (CID 130834810) is (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine.
What is the SMILES notation for (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine?
The canonical SMILES for (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine is C=C1CCN(C[C@H](N)C(C)(C)C)CC1.
What is the InChIKey of (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine?
The InChIKey is WSSYZQUVBBTGHB-NSHDSACASA-N. The full InChI is InChI=1S/C12H24N2/c1-10-5-7-14(8-6-10)9-11(13)12(2,3)4/h11H,1,5-9,13H2,2-4H3/t11-/m0/s1.
What are the key properties of (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine?
(2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine has a molecular weight of 196.34 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-dimethyl-1-(4-methylidenepiperidin-1-yl)butan-2-amine is sourced from PubChem (CID 130834810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).