C10H14N2O2 — CID 130834966
[3-(pyridin-4-ylamino)oxolan-3-yl]methanol (PubChem CID 130834966) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is [3-(pyridin-4-ylamino)oxolan-3-yl]methanol.
| Compound Name | [3-(pyridin-4-ylamino)oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 130834966 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | [3-(pyridin-4-ylamino)oxolan-3-yl]methanol |
| SMILES | OCC1(Nc2ccncc2)CCOC1 |
| InChI | InChI=1S/C10H14N2O2/c13-7-10(3-6-14-8-10)12-9-1-4-11-5-2-9/h1-2,4-5,13H,3,6-8H2,(H,11,12) |
| InChIKey | HONXYOVQNMVKOE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |