About (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride
(2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride (PubChem CID 130835190) has the molecular formula C9H16ClFN2O
and a molecular weight of 222.69 g/mol. Its IUPAC name is (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride |
| PubChem CID | 130835190 |
| Molecular Formula | C9H16ClFN2O |
| Molecular Weight | 222.69 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride |
| SMILES | C=CC(C)NC(=O)[C@H]1C[C@H](F)CN1.Cl |
| InChI | InChI=1S/C9H15FN2O.ClH/c1-3-6(2)12-9(13)8-4-7(10)5-11-8;/h3,6-8,11H,1,4-5H2,2H3,(H,12,13);1H/t6?,7-,8+;/m0./s1 |
| InChIKey | ZCRPRRYTPJPTOH-UJXVHCJJSA-N |
| XLogP | 0.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride?
The IUPAC name of (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride (CID 130835190) is (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride.
What is the SMILES notation for (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride?
The canonical SMILES for (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride is C=CC(C)NC(=O)[C@H]1C[C@H](F)CN1.Cl.
What is the InChIKey of (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride?
The InChIKey is ZCRPRRYTPJPTOH-UJXVHCJJSA-N. The full InChI is InChI=1S/C9H15FN2O.ClH/c1-3-6(2)12-9(13)8-4-7(10)5-11-8;/h3,6-8,11H,1,4-5H2,2H3,(H,12,13);1H/t6?,7-,8+;/m0./s1.
What are the key properties of (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride?
(2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride has a molecular weight of 222.69 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 130835190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).