C9H10ClNOS — CID 130835210
N-(2-chloroprop-2-enyl)-4-methylthiophene-2-carboxamide (PubChem CID 130835210) has the molecular formula C9H10ClNOS and a molecular weight of 215.70 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-4-methylthiophene-2-carboxamide.
| Compound Name | N-(2-chloroprop-2-enyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 130835210 |
| Molecular Formula | C9H10ClNOS |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-4-methylthiophene-2-carboxamide |
| SMILES | C=C(Cl)CNC(=O)c1cc(C)cs1 |
| InChI | InChI=1S/C9H10ClNOS/c1-6-3-8(13-5-6)9(12)11-4-7(2)10/h3,5H,2,4H2,1H3,(H,11,12) |
| InChIKey | MHCPPKHIGOZIHU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |