C9H15N3S — CID 130835395
5-N-(2,3-dimethylcyclobutyl)-1,2-thiazole-3,5-diamine (PubChem CID 130835395) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-N-(2,3-dimethylcyclobutyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2,3-dimethylcyclobutyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 130835395 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-N-(2,3-dimethylcyclobutyl)-1,2-thiazole-3,5-diamine |
| SMILES | CC1CC(Nc2cc(N)ns2)C1C |
| InChI | InChI=1S/C9H15N3S/c1-5-3-7(6(5)2)11-9-4-8(10)12-13-9/h4-7,11H,3H2,1-2H3,(H2,10,12) |
| InChIKey | OTZCLFCVFATDDD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |