About 4-(ethylamino)-1,2-oxazolidin-3-one
4-(ethylamino)-1,2-oxazolidin-3-one (PubChem CID 130835768) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 4-(ethylamino)-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 4-(ethylamino)-1,2-oxazolidin-3-one |
| PubChem CID | 130835768 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 4-(ethylamino)-1,2-oxazolidin-3-one |
| SMILES | CCNC1CONC1=O |
| InChI | InChI=1S/C5H10N2O2/c1-2-6-4-3-9-7-5(4)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | HRNLYKNIIDWXEP-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(ethylamino)-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-1,2-oxazolidin-3-one?
The IUPAC name of 4-(ethylamino)-1,2-oxazolidin-3-one (CID 130835768) is 4-(ethylamino)-1,2-oxazolidin-3-one.
What is the SMILES notation for 4-(ethylamino)-1,2-oxazolidin-3-one?
The canonical SMILES for 4-(ethylamino)-1,2-oxazolidin-3-one is CCNC1CONC1=O.
What is the InChIKey of 4-(ethylamino)-1,2-oxazolidin-3-one?
The InChIKey is HRNLYKNIIDWXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-2-6-4-3-9-7-5(4)8/h4,6H,2-3H2,1H3,(H,7,8).
What are the key properties of 4-(ethylamino)-1,2-oxazolidin-3-one?
4-(ethylamino)-1,2-oxazolidin-3-one has a molecular weight of 130.15 g/mol, XLogP of -0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-1,2-oxazolidin-3-one is sourced from PubChem (CID 130835768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).