C12H23NO — CID 13083639
3,5-ditert-butyl-4-methyl-4,5-dihydro-1,2-oxazole (PubChem CID 13083639) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-methyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 3,5-ditert-butyl-4-methyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 13083639 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3,5-ditert-butyl-4-methyl-4,5-dihydro-1,2-oxazole |
| SMILES | CC1C(C(C)(C)C)=NOC1C(C)(C)C |
| InChI | InChI=1S/C12H23NO/c1-8-9(11(2,3)4)13-14-10(8)12(5,6)7/h8,10H,1-7H3 |
| InChIKey | IRNOKSPMSPJQSD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |