About 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole
5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole (PubChem CID 13083663) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 13083663 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole |
| SMILES | CC(C)C1C(c2ccccc2)=NOC1C |
| InChI | InChI=1S/C13H17NO/c1-9(2)12-10(3)15-14-13(12)11-7-5-4-6-8-11/h4-10,12H,1-3H3 |
| InChIKey | KXPYTDVARCRSQT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole (CID 13083663) is 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole is CC(C)C1C(c2ccccc2)=NOC1C.
What is the InChIKey of 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole?
The InChIKey is KXPYTDVARCRSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9(2)12-10(3)15-14-13(12)11-7-5-4-6-8-11/h4-10,12H,1-3H3.
What are the key properties of 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole?
5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole has a molecular weight of 203.29 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-phenyl-4-propan-2-yl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 13083663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).