C9H7Br3O — CID 130837160
1-bromo-3-(2,5-dibromophenyl)propan-2-one (PubChem CID 130837160) has the molecular formula C9H7Br3O and a molecular weight of 370.87 g/mol. Its IUPAC name is 1-bromo-3-(2,5-dibromophenyl)propan-2-one.
| Compound Name | 1-bromo-3-(2,5-dibromophenyl)propan-2-one |
|---|---|
| PubChem CID | 130837160 |
| Molecular Formula | C9H7Br3O |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 367.80 |
| IUPAC Name | 1-bromo-3-(2,5-dibromophenyl)propan-2-one |
| SMILES | O=C(CBr)Cc1cc(Br)ccc1Br |
| InChI | InChI=1S/C9H7Br3O/c10-5-8(13)4-6-3-7(11)1-2-9(6)12/h1-3H,4-5H2 |
| InChIKey | KULLZKDSOMJDLB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|