3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride

C7H2BrCl2NO2S — CID 130837661

IUPAC3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride
SMILESN#Cc1c(Br)cc(Cl)cc1S(=O)(=O)Cl
InChIInChI=1S/C7H2BrCl2NO2S/c8-6-1-4(9)2-7(5(6)3-11)14(10,12)13/h1-2H
InChIKeyUCNDJVHTQKHNRB-UHFFFAOYSA-N
MW314.98 g/mol
LogP2.90
Rot. Bonds1

About 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride

3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride (PubChem CID 130837661) has the molecular formula C7H2BrCl2NO2S and a molecular weight of 314.98 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride.

Molecular Properties

Compound Name3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride
PubChem CID130837661
Molecular FormulaC7H2BrCl2NO2S
Molecular Weight314.98 g/mol
Exact Mass312.84
IUPAC Name3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride
SMILESN#Cc1c(Br)cc(Cl)cc1S(=O)(=O)Cl
InChIInChI=1S/C7H2BrCl2NO2S/c8-6-1-4(9)2-7(5(6)3-11)14(10,12)13/h1-2H
InChIKeyUCNDJVHTQKHNRB-UHFFFAOYSA-N
XLogP2.90
TPSA57.93 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.98
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-Bromo-5-chloro-2-methylbenzenesulfonyl chloride
CID 153327466
3-Bromo-5-chloro-2-methylbenzenesulfonamide
CID 53443946
4-Bromo-3-chloro-5-cyanobenzenesulfonyl chloride
CID 118827415
4-Bromo-2-chloro-5-cyanobenzenesulfonyl chloride
CID 118850267
2-Bromo-5-chloro-3-cyanobenzene-1-sulfonyl chloride
CID 130777781
2-Bromo-6-chloro-3-cyanobenzenesulfonyl chloride
CID 130820712
2-Bromo-3-chloro-6-cyanobenzene-1-sulfonyl chloride
CID 130839428
3-Bromo-6-chloro-2-cyanobenzenesulfonyl chloride
CID 130952264
3-Bromo-4-chloro-2-cyanobenzenesulfonyl chloride
CID 130952605
5-Bromo-3-chloro-2-cyanobenzenesulfonyl chloride
CID 130971393
3-Bromo-5-chloro-4-cyanobenzenesulfonyl chloride
CID 130980944
4-Bromo-5-chloro-2-cyanobenzenesulfonyl chloride
CID 131076854

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride?
The IUPAC name of 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride (CID 130837661) is 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride.
What is the SMILES notation for 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride?
The canonical SMILES for 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride is N#Cc1c(Br)cc(Cl)cc1S(=O)(=O)Cl.
What is the InChIKey of 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride?
The InChIKey is UCNDJVHTQKHNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrCl2NO2S/c8-6-1-4(9)2-7(5(6)3-11)14(10,12)13/h1-2H.
What are the key properties of 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride?
3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride has a molecular weight of 314.98 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-chloro-2-cyanobenzenesulfonyl chloride is sourced from PubChem (CID 130837661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).