C9H6O3S — CID 130839061
3,7-dihydroxy-1-benzothiophene-4-carbaldehyde (PubChem CID 130839061) has the molecular formula C9H6O3S and a molecular weight of 194.21 g/mol. Its IUPAC name is 3,7-dihydroxy-1-benzothiophene-4-carbaldehyde.
| Compound Name | 3,7-dihydroxy-1-benzothiophene-4-carbaldehyde |
|---|---|
| PubChem CID | 130839061 |
| Molecular Formula | C9H6O3S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 3,7-dihydroxy-1-benzothiophene-4-carbaldehyde |
| SMILES | O=Cc1ccc(O)c2scc(O)c12 |
| InChI | InChI=1S/C9H6O3S/c10-3-5-1-2-6(11)9-8(5)7(12)4-13-9/h1-4,11-12H |
| InChIKey | AKPIMOLBBQLUNW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|