C8H9NO3 — CID 130839592
(7S,8R)-7-hydroxy-5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde (PubChem CID 130839592) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is (7S,8R)-7-hydroxy-5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde.
| Compound Name | (7S,8R)-7-hydroxy-5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde |
|---|---|
| PubChem CID | 130839592 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (7S,8R)-7-hydroxy-5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde |
| SMILES | O=CC1=CCN2C(=O)C[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C8H9NO3/c10-4-5-1-2-9-7(12)3-6(11)8(5)9/h1,4,6,8,11H,2-3H2/t6-,8+/m0/s1 |
| InChIKey | OLVYXAOFUDUGIA-POYBYMJQSA-N |
| XLogP | -0.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|