C8H10N4O — CID 130840348
1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one (PubChem CID 130840348) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one.
| Compound Name | 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 130840348 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2n[nH]nc2C1 |
| InChI | InChI=1S/C8H10N4O/c1-2-8(13)12-4-3-6-7(5-12)10-11-9-6/h2H,1,3-5H2,(H,9,10,11) |
| InChIKey | JYQHUZUFDRHGOA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|