C12H14N2O4 — CID 13084037
2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)-N-phenylacetamide (PubChem CID 13084037) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)-N-phenylacetamide.
| Compound Name | 2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 13084037 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)-N-phenylacetamide |
| SMILES | COCC(=O)N(c1ccccc1)N1CCOC1=O |
| InChI | InChI=1S/C12H14N2O4/c1-17-9-11(15)14(10-5-3-2-4-6-10)13-7-8-18-12(13)16/h2-6H,7-9H2,1H3 |
| InChIKey | VPFDYRBUNYKGNV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |