About 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone
2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone (PubChem CID 130840859) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone |
| PubChem CID | 130840859 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone |
| SMILES | O=C(CN1CCC1)c1ccns1 |
| InChI | InChI=1S/C8H10N2OS/c11-7(6-10-4-1-5-10)8-2-3-9-12-8/h2-3H,1,4-6H2 |
| InChIKey | JOAVIPSFPRCDLX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone?
The IUPAC name of 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone (CID 130840859) is 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone.
What is the SMILES notation for 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone?
The canonical SMILES for 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone is O=C(CN1CCC1)c1ccns1.
What is the InChIKey of 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone?
The InChIKey is JOAVIPSFPRCDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c11-7(6-10-4-1-5-10)8-2-3-9-12-8/h2-3H,1,4-6H2.
What are the key properties of 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone?
2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone has a molecular weight of 182.25 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-1-yl)-1-(1,2-thiazol-5-yl)ethanone is sourced from PubChem (CID 130840859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).