2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid

C10H15FN2O2 — CID 130840915

IUPAC2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid
SMILESCc1nn(C)c(C)c1C(C)C(F)C(=O)O
InChIInChI=1S/C10H15FN2O2/c1-5(9(11)10(14)15)8-6(2)12-13(4)7(8)3/h5,9H,1-4H3,(H,14,15)
InChIKeyVNQAHCUYJBYEPE-UHFFFAOYSA-N
MW214.24 g/mol
LogP1.56
Rot. Bonds3

About 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid

2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid (PubChem CID 130840915) has the molecular formula C10H15FN2O2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid.

Molecular Properties

Compound Name2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid
PubChem CID130840915
Molecular FormulaC10H15FN2O2
Molecular Weight214.24 g/mol
Exact Mass214.11
IUPAC Name2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid
SMILESCc1nn(C)c(C)c1C(C)C(F)C(=O)O
InChIInChI=1S/C10H15FN2O2/c1-5(9(11)10(14)15)8-6(2)12-13(4)7(8)3/h5,9H,1-4H3,(H,14,15)
InChIKeyVNQAHCUYJBYEPE-UHFFFAOYSA-N
XLogP1.56
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.24
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid?
The IUPAC name of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid (CID 130840915) is 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid.
What is the SMILES notation for 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid?
The canonical SMILES for 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid is Cc1nn(C)c(C)c1C(C)C(F)C(=O)O.
What is the InChIKey of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid?
The InChIKey is VNQAHCUYJBYEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O2/c1-5(9(11)10(14)15)8-6(2)12-13(4)7(8)3/h5,9H,1-4H3,(H,14,15).
What are the key properties of 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid?
2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid has a molecular weight of 214.24 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-(1,3,5-trimethylpyrazol-4-yl)butanoic acid is sourced from PubChem (CID 130840915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).