About 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide
2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide (PubChem CID 130841222) has the molecular formula C6H6BrCl2F2NO
and a molecular weight of 296.93 g/mol. Its IUPAC name is 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide |
| PubChem CID | 130841222 |
| Molecular Formula | C6H6BrCl2F2NO |
| Molecular Weight | 296.93 g/mol |
| Exact Mass | 294.90 |
| IUPAC Name | 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide |
| SMILES | O=C(NCC1CC1(Cl)Cl)C(F)(F)Br |
| InChI | InChI=1S/C6H6BrCl2F2NO/c7-6(10,11)4(13)12-2-3-1-5(3,8)9/h3H,1-2H2,(H,12,13) |
| InChIKey | MTWZRNHUQKMZGR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.93 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide?
The IUPAC name of 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide (CID 130841222) is 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide.
What is the SMILES notation for 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide?
The canonical SMILES for 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide is O=C(NCC1CC1(Cl)Cl)C(F)(F)Br.
What is the InChIKey of 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide?
The InChIKey is MTWZRNHUQKMZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrCl2F2NO/c7-6(10,11)4(13)12-2-3-1-5(3,8)9/h3H,1-2H2,(H,12,13).
What are the key properties of 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide?
2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide has a molecular weight of 296.93 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(2,2-dichlorocyclopropyl)methyl]-2,2-difluoroacetamide is sourced from PubChem (CID 130841222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).