C15H20O2 — CID 13084384
3-hydroxy-3a,6-dimethyl-2,3,8,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 13084384) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-hydroxy-3a,6-dimethyl-2,3,8,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | 3-hydroxy-3a,6-dimethyl-2,3,8,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 13084384 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 3-hydroxy-3a,6-dimethyl-2,3,8,9,9a,9b-hexahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | CC1=C2C=CC3(C)C(O)CCC3C2CCC1=O |
| InChI | InChI=1S/C15H20O2/c1-9-10-7-8-15(2)12(4-6-14(15)17)11(10)3-5-13(9)16/h7-8,11-12,14,17H,3-6H2,1-2H3 |
| InChIKey | NYVZYABSZXZXMK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |