About 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine
1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine (PubChem CID 130847097) has the molecular formula C11H19FN2
and a molecular weight of 198.28 g/mol. Its IUPAC name is 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine.
Molecular Properties
| Compound Name | 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine |
| PubChem CID | 130847097 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine |
| SMILES | CNC1(CN2CCC=C(F)C2)CCC1 |
| InChI | InChI=1S/C11H19FN2/c1-13-11(5-3-6-11)9-14-7-2-4-10(12)8-14/h4,13H,2-3,5-9H2,1H3 |
| InChIKey | GYXRPXXSBQVNNC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine?
The IUPAC name of 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine (CID 130847097) is 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine.
What is the SMILES notation for 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine?
The canonical SMILES for 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine is CNC1(CN2CCC=C(F)C2)CCC1.
What is the InChIKey of 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine?
The InChIKey is GYXRPXXSBQVNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FN2/c1-13-11(5-3-6-11)9-14-7-2-4-10(12)8-14/h4,13H,2-3,5-9H2,1H3.
What are the key properties of 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine?
1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine has a molecular weight of 198.28 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)methyl]-N-methylcyclobutan-1-amine is sourced from PubChem (CID 130847097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).