C10H16N2O — CID 13084755
6-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonitrile (PubChem CID 13084755) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonitrile.
| Compound Name | 6-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonitrile |
|---|---|
| PubChem CID | 13084755 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 6-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonitrile |
| SMILES | N#CN1CCCC2CC(O)CCC21 |
| InChI | InChI=1S/C10H16N2O/c11-7-12-5-1-2-8-6-9(13)3-4-10(8)12/h8-10,13H,1-6H2 |
| InChIKey | UHJBGLQRPRBXAQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|