About 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea
1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea (PubChem CID 130847628) has the molecular formula C6H11F2N3O
and a molecular weight of 179.17 g/mol. Its IUPAC name is 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea.
Molecular Properties
| Compound Name | 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea |
| PubChem CID | 130847628 |
| Molecular Formula | C6H11F2N3O |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea |
| SMILES | NNC(=O)NCC1CC(F)(F)C1 |
| InChI | InChI=1S/C6H11F2N3O/c7-6(8)1-4(2-6)3-10-5(12)11-9/h4H,1-3,9H2,(H2,10,11,12) |
| InChIKey | JCLQBRSIMAARMW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea?
The IUPAC name of 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea (CID 130847628) is 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea.
What is the SMILES notation for 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea?
The canonical SMILES for 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea is NNC(=O)NCC1CC(F)(F)C1.
What is the InChIKey of 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea?
The InChIKey is JCLQBRSIMAARMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N3O/c7-6(8)1-4(2-6)3-10-5(12)11-9/h4H,1-3,9H2,(H2,10,11,12).
What are the key properties of 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea?
1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea has a molecular weight of 179.17 g/mol, XLogP of 0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[(3,3-difluorocyclobutyl)methyl]urea is sourced from PubChem (CID 130847628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).