About 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one
3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (PubChem CID 130847634) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| PubChem CID | 130847634 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| SMILES | CC(O)Cn1cnc2c(c1=O)CCC2 |
| InChI | InChI=1S/C10H14N2O2/c1-7(13)5-12-6-11-9-4-2-3-8(9)10(12)14/h6-7,13H,2-5H2,1H3 |
| InChIKey | TUELTRXIKDICIB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The IUPAC name of 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (CID 130847634) is 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
What is the SMILES notation for 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The canonical SMILES for 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is CC(O)Cn1cnc2c(c1=O)CCC2.
What is the InChIKey of 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The InChIKey is TUELTRXIKDICIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-7(13)5-12-6-11-9-4-2-3-8(9)10(12)14/h6-7,13H,2-5H2,1H3.
What are the key properties of 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one has a molecular weight of 194.23 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxypropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is sourced from PubChem (CID 130847634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).