About (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine
(3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 130848036) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
Molecular Properties
| Compound Name | (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| PubChem CID | 130848036 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | NC1=N[C@@H](c2ccc(F)cc2)COC1 |
| InChI | InChI=1S/C10H11FN2O/c11-8-3-1-7(2-4-8)9-5-14-6-10(12)13-9/h1-4,9H,5-6H2,(H2,12,13)/t9-/m1/s1 |
| InChIKey | DMTIBCSSHKBNBX-SECBINFHSA-N |
| XLogP | 1.25 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
The IUPAC name of (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (CID 130848036) is (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
What is the SMILES notation for (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
The canonical SMILES for (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine is NC1=N[C@@H](c2ccc(F)cc2)COC1.
What is the InChIKey of (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
The InChIKey is DMTIBCSSHKBNBX-SECBINFHSA-N. The full InChI is InChI=1S/C10H11FN2O/c11-8-3-1-7(2-4-8)9-5-14-6-10(12)13-9/h1-4,9H,5-6H2,(H2,12,13)/t9-/m1/s1.
What are the key properties of (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine?
(3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine has a molecular weight of 194.21 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(4-fluorophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine is sourced from PubChem (CID 130848036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).