C13H23NO — CID 130848658
1,3,3-trimethyl-6-[[(2R)-oxiran-2-yl]methyl]-6-azabicyclo[3.2.1]octane (PubChem CID 130848658) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-[[(2R)-oxiran-2-yl]methyl]-6-azabicyclo[3.2.1]octane.
| Compound Name | 1,3,3-trimethyl-6-[[(2R)-oxiran-2-yl]methyl]-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 130848658 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1,3,3-trimethyl-6-[[(2R)-oxiran-2-yl]methyl]-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@@H]2CO2)C1 |
| InChI | InChI=1S/C13H23NO/c1-12(2)4-10-5-13(3,8-12)9-14(10)6-11-7-15-11/h10-11H,4-9H2,1-3H3/t10?,11-,13?/m1/s1 |
| InChIKey | QWQVNFFKSIALQB-QWKFWESOSA-N |
| XLogP | 2.29 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|