About [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine
[oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 130848693) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| PubChem CID | 130848693 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsn1)C1CCCOC1 |
| InChI | InChI=1S/C9H15N3OS/c10-11-9(8-3-5-14-12-8)7-2-1-4-13-6-7/h3,5,7,9,11H,1-2,4,6,10H2 |
| InChIKey | UCIIQBJIOWHZIA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The IUPAC name of [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine (CID 130848693) is [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine.
What is the SMILES notation for [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The canonical SMILES for [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine is NNC(c1ccsn1)C1CCCOC1.
What is the InChIKey of [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The InChIKey is UCIIQBJIOWHZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c10-11-9(8-3-5-14-12-8)7-2-1-4-13-6-7/h3,5,7,9,11H,1-2,4,6,10H2.
What are the key properties of [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine?
[oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine has a molecular weight of 213.31 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [oxan-3-yl(1,2-thiazol-3-yl)methyl]hydrazine is sourced from PubChem (CID 130848693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).