About 3-methyl-2-phenyl-2,3-dihydropyran-4-one
3-methyl-2-phenyl-2,3-dihydropyran-4-one (PubChem CID 13084989) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-methyl-2-phenyl-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-phenyl-2,3-dihydropyran-4-one |
| PubChem CID | 13084989 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-methyl-2-phenyl-2,3-dihydropyran-4-one |
| SMILES | CC1C(=O)C=COC1c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-9-11(13)7-8-14-12(9)10-5-3-2-4-6-10/h2-9,12H,1H3 |
| InChIKey | WUYVRAIMUAGDMF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-phenyl-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-phenyl-2,3-dihydropyran-4-one?
The IUPAC name of 3-methyl-2-phenyl-2,3-dihydropyran-4-one (CID 13084989) is 3-methyl-2-phenyl-2,3-dihydropyran-4-one.
What is the SMILES notation for 3-methyl-2-phenyl-2,3-dihydropyran-4-one?
The canonical SMILES for 3-methyl-2-phenyl-2,3-dihydropyran-4-one is CC1C(=O)C=COC1c1ccccc1.
What is the InChIKey of 3-methyl-2-phenyl-2,3-dihydropyran-4-one?
The InChIKey is WUYVRAIMUAGDMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-9-11(13)7-8-14-12(9)10-5-3-2-4-6-10/h2-9,12H,1H3.
What are the key properties of 3-methyl-2-phenyl-2,3-dihydropyran-4-one?
3-methyl-2-phenyl-2,3-dihydropyran-4-one has a molecular weight of 188.23 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-phenyl-2,3-dihydropyran-4-one is sourced from PubChem (CID 13084989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).