About N'-benzoylbenzohydrazide
N'-benzoylbenzohydrazide (PubChem CID 13085) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is N'-benzoylbenzohydrazide.
Molecular Properties
| Compound Name | N'-benzoylbenzohydrazide |
| PubChem CID | 13085 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N'-benzoylbenzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2/c17-13(11-7-3-1-4-8-11)15-16-14(18)12-9-5-2-6-10-12/h1-10H,(H,15,17)(H,16,18) |
| InChIKey | GRRIYLZJLGTQJX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzoylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzoylbenzohydrazide?
The IUPAC name of N'-benzoylbenzohydrazide (CID 13085) is N'-benzoylbenzohydrazide.
What is the SMILES notation for N'-benzoylbenzohydrazide?
The canonical SMILES for N'-benzoylbenzohydrazide is O=C(NNC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of N'-benzoylbenzohydrazide?
The InChIKey is GRRIYLZJLGTQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c17-13(11-7-3-1-4-8-11)15-16-14(18)12-9-5-2-6-10-12/h1-10H,(H,15,17)(H,16,18).
What are the key properties of N'-benzoylbenzohydrazide?
N'-benzoylbenzohydrazide has a molecular weight of 240.26 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzoylbenzohydrazide is sourced from PubChem (CID 13085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).