C5H9N3O4 — CID 130850376
(2R,3R,4S,5R)-5-(azidomethyl)oxolane-2,3,4-triol (PubChem CID 130850376) has the molecular formula C5H9N3O4 and a molecular weight of 175.14 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-(azidomethyl)oxolane-2,3,4-triol.
| Compound Name | (2R,3R,4S,5R)-5-(azidomethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 130850376 |
| Molecular Formula | C5H9N3O4 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (2R,3R,4S,5R)-5-(azidomethyl)oxolane-2,3,4-triol |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H9N3O4/c6-8-7-1-2-3(9)4(10)5(11)12-2/h2-5,9-11H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChIKey | FPNYNARZVKFPAC-TXICZTDVSA-N |
| XLogP | -1.26 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|