About methyl (E)-2,2-dichloro-3-methylhex-4-enoate
methyl (E)-2,2-dichloro-3-methylhex-4-enoate (PubChem CID 13085120) has the molecular formula C8H12Cl2O2
and a molecular weight of 211.09 g/mol. Its IUPAC name is methyl (E)-2,2-dichloro-3-methylhex-4-enoate.
Molecular Properties
| Compound Name | methyl (E)-2,2-dichloro-3-methylhex-4-enoate |
| PubChem CID | 13085120 |
| Molecular Formula | C8H12Cl2O2 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | methyl (E)-2,2-dichloro-3-methylhex-4-enoate |
| SMILES | C/C=C/C(C)C(Cl)(Cl)C(=O)OC |
| InChI | InChI=1S/C8H12Cl2O2/c1-4-5-6(2)8(9,10)7(11)12-3/h4-6H,1-3H3/b5-4+ |
| InChIKey | UYEOTIVEAWMWDS-SNAWJCMRSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2,2-dichloro-3-methylhex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2,2-dichloro-3-methylhex-4-enoate?
The IUPAC name of methyl (E)-2,2-dichloro-3-methylhex-4-enoate (CID 13085120) is methyl (E)-2,2-dichloro-3-methylhex-4-enoate.
What is the SMILES notation for methyl (E)-2,2-dichloro-3-methylhex-4-enoate?
The canonical SMILES for methyl (E)-2,2-dichloro-3-methylhex-4-enoate is C/C=C/C(C)C(Cl)(Cl)C(=O)OC.
What is the InChIKey of methyl (E)-2,2-dichloro-3-methylhex-4-enoate?
The InChIKey is UYEOTIVEAWMWDS-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H12Cl2O2/c1-4-5-6(2)8(9,10)7(11)12-3/h4-6H,1-3H3/b5-4+.
What are the key properties of methyl (E)-2,2-dichloro-3-methylhex-4-enoate?
methyl (E)-2,2-dichloro-3-methylhex-4-enoate has a molecular weight of 211.09 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2,2-dichloro-3-methylhex-4-enoate is sourced from PubChem (CID 13085120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).