About methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate
methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate (PubChem CID 13085137) has the molecular formula C9H12Cl4O2
and a molecular weight of 294.01 g/mol. Its IUPAC name is methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate.
Molecular Properties
| Compound Name | methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate |
| PubChem CID | 13085137 |
| Molecular Formula | C9H12Cl4O2 |
| Molecular Weight | 294.01 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate |
| SMILES | C=CC(C)C(Cl)(CC(Cl)(Cl)Cl)C(=O)OC |
| InChI | InChI=1S/C9H12Cl4O2/c1-4-6(2)8(10,7(14)15-3)5-9(11,12)13/h4,6H,1,5H2,2-3H3 |
| InChIKey | SNQWDGJUVSBUKG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.01 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate?
The IUPAC name of methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate (CID 13085137) is methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate.
What is the SMILES notation for methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate?
The canonical SMILES for methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate is C=CC(C)C(Cl)(CC(Cl)(Cl)Cl)C(=O)OC.
What is the InChIKey of methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate?
The InChIKey is SNQWDGJUVSBUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl4O2/c1-4-6(2)8(10,7(14)15-3)5-9(11,12)13/h4,6H,1,5H2,2-3H3.
What are the key properties of methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate?
methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate has a molecular weight of 294.01 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-3-methyl-2-(2,2,2-trichloroethyl)pent-4-enoate is sourced from PubChem (CID 13085137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).