C10H15ClO2 — CID 13085153
(6E)-9-chloro-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 13085153) has the molecular formula C10H15ClO2 and a molecular weight of 202.68 g/mol. Its IUPAC name is (6E)-9-chloro-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (6E)-9-chloro-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 13085153 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (6E)-9-chloro-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CC1CCC/C=C/CC(Cl)C(=O)O1 |
| InChI | InChI=1S/C10H15ClO2/c1-8-6-4-2-3-5-7-9(11)10(12)13-8/h3,5,8-9H,2,4,6-7H2,1H3/b5-3+ |
| InChIKey | FLPZNNWTRNIYIN-HWKANZROSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|