C10H16O2 — CID 13085155
(6Z)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 13085155) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (6Z)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (6Z)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 13085155 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (6Z)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CC1CCC/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C10H16O2/c1-9-7-5-3-2-4-6-8-10(11)12-9/h2,4,9H,3,5-8H2,1H3/b4-2- |
| InChIKey | UEQXZLBVNLFTBE-RQOWECAXSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|