About 1,1-dimethyl-3H-2,1-benzoxasilole
1,1-dimethyl-3H-2,1-benzoxasilole (PubChem CID 13085174) has the molecular formula C9H12OSi
and a molecular weight of 164.28 g/mol. Its IUPAC name is 1,1-dimethyl-3H-2,1-benzoxasilole.
Molecular Properties
| Compound Name | 1,1-dimethyl-3H-2,1-benzoxasilole |
| PubChem CID | 13085174 |
| Molecular Formula | C9H12OSi |
| Molecular Weight | 164.28 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1,1-dimethyl-3H-2,1-benzoxasilole |
| SMILES | C[Si]1(C)OCc2ccccc21 |
| InChI | InChI=1S/C9H12OSi/c1-11(2)9-6-4-3-5-8(9)7-10-11/h3-6H,7H2,1-2H3 |
| InChIKey | GLZOQCBCUKBUJG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-3H-2,1-benzoxasilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3H-2,1-benzoxasilole?
The IUPAC name of 1,1-dimethyl-3H-2,1-benzoxasilole (CID 13085174) is 1,1-dimethyl-3H-2,1-benzoxasilole.
What is the SMILES notation for 1,1-dimethyl-3H-2,1-benzoxasilole?
The canonical SMILES for 1,1-dimethyl-3H-2,1-benzoxasilole is C[Si]1(C)OCc2ccccc21.
What is the InChIKey of 1,1-dimethyl-3H-2,1-benzoxasilole?
The InChIKey is GLZOQCBCUKBUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12OSi/c1-11(2)9-6-4-3-5-8(9)7-10-11/h3-6H,7H2,1-2H3.
What are the key properties of 1,1-dimethyl-3H-2,1-benzoxasilole?
1,1-dimethyl-3H-2,1-benzoxasilole has a molecular weight of 164.28 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3H-2,1-benzoxasilole is sourced from PubChem (CID 13085174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).