C16H22N4S — CID 130855413
2-N-(1-benzyl-3-methylpiperidin-4-yl)-1,3-thiazole-2,5-diamine (PubChem CID 130855413) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 2-N-(1-benzyl-3-methylpiperidin-4-yl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(1-benzyl-3-methylpiperidin-4-yl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 130855413 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-N-(1-benzyl-3-methylpiperidin-4-yl)-1,3-thiazole-2,5-diamine |
| SMILES | CC1CN(Cc2ccccc2)CCC1Nc1ncc(N)s1 |
| InChI | InChI=1S/C16H22N4S/c1-12-10-20(11-13-5-3-2-4-6-13)8-7-14(12)19-16-18-9-15(17)21-16/h2-6,9,12,14H,7-8,10-11,17H2,1H3,(H,18,19) |
| InChIKey | QBNAADHDFAZMSU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |