About [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol
[2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol (PubChem CID 130855887) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol |
| PubChem CID | 130855887 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol |
| SMILES | COc1cc(C2CC2CO)sn1 |
| InChI | InChI=1S/C8H11NO2S/c1-11-8-3-7(12-9-8)6-2-5(6)4-10/h3,5-6,10H,2,4H2,1H3 |
| InChIKey | ULUINNHUILFBKB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol?
The IUPAC name of [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol (CID 130855887) is [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol.
What is the SMILES notation for [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol?
The canonical SMILES for [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol is COc1cc(C2CC2CO)sn1.
What is the InChIKey of [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol?
The InChIKey is ULUINNHUILFBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-11-8-3-7(12-9-8)6-2-5(6)4-10/h3,5-6,10H,2,4H2,1H3.
What are the key properties of [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol?
[2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol has a molecular weight of 185.25 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methoxy-1,2-thiazol-5-yl)cyclopropyl]methanol is sourced from PubChem (CID 130855887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).