About 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol
1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol (PubChem CID 130855945) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol |
| PubChem CID | 130855945 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol |
| SMILES | CC(O)(c1ccns1)C1C2CNC1C2 |
| InChI | InChI=1S/C10H14N2OS/c1-10(13,8-2-3-12-14-8)9-6-4-7(9)11-5-6/h2-3,6-7,9,11,13H,4-5H2,1H3 |
| InChIKey | WOGGZUFTXLVSLW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol?
The IUPAC name of 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol (CID 130855945) is 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol.
What is the SMILES notation for 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol?
The canonical SMILES for 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol is CC(O)(c1ccns1)C1C2CNC1C2.
What is the InChIKey of 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol?
The InChIKey is WOGGZUFTXLVSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-10(13,8-2-3-12-14-8)9-6-4-7(9)11-5-6/h2-3,6-7,9,11,13H,4-5H2,1H3.
What are the key properties of 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol?
1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol has a molecular weight of 210.30 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-azabicyclo[2.1.1]hexan-5-yl)-1-(1,2-thiazol-5-yl)ethanol is sourced from PubChem (CID 130855945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).