About 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one
1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one (PubChem CID 130856209) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one |
| PubChem CID | 130856209 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one |
| SMILES | C[C@@H]1C[C@H](O)CN(CC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C12H23NO2/c1-9-5-10(14)7-13(6-9)8-11(15)12(2,3)4/h9-10,14H,5-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | AHBWAPXXYLJAMV-ZJUUUORDSA-N |
| XLogP | 1.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one?
The IUPAC name of 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one (CID 130856209) is 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one is C[C@@H]1C[C@H](O)CN(CC(=O)C(C)(C)C)C1.
What is the InChIKey of 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one?
The InChIKey is AHBWAPXXYLJAMV-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H23NO2/c1-9-5-10(14)7-13(6-9)8-11(15)12(2,3)4/h9-10,14H,5-8H2,1-4H3/t9-,10+/m1/s1.
What are the key properties of 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one?
1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one has a molecular weight of 213.32 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,5R)-3-hydroxy-5-methylpiperidin-1-yl]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 130856209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).