C8H14O3 — CID 130857690
(5R,9S)-1,6-dioxaspiro[4.5]decan-9-ol (PubChem CID 130857690) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (5R,9S)-1,6-dioxaspiro[4.5]decan-9-ol.
| Compound Name | (5R,9S)-1,6-dioxaspiro[4.5]decan-9-ol |
|---|---|
| PubChem CID | 130857690 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (5R,9S)-1,6-dioxaspiro[4.5]decan-9-ol |
| SMILES | O[C@H]1CCO[C@]2(CCCO2)C1 |
| InChI | InChI=1S/C8H14O3/c9-7-2-5-11-8(6-7)3-1-4-10-8/h7,9H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | HMMAOKRBIYSPTB-JGVFFNPUSA-N |
| XLogP | 0.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |