C6H9F2NO — CID 130859227
N-[(3,3-difluorocyclobutyl)methyl]formamide (PubChem CID 130859227) has the molecular formula C6H9F2NO and a molecular weight of 149.14 g/mol. Its IUPAC name is N-[(3,3-difluorocyclobutyl)methyl]formamide.
| Compound Name | N-[(3,3-difluorocyclobutyl)methyl]formamide |
|---|---|
| PubChem CID | 130859227 |
| Molecular Formula | C6H9F2NO |
| Molecular Weight | 149.14 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | N-[(3,3-difluorocyclobutyl)methyl]formamide |
| SMILES | O=CNCC1CC(F)(F)C1 |
| InChI | InChI=1S/C6H9F2NO/c7-6(8)1-5(2-6)3-9-4-10/h4-5H,1-3H2,(H,9,10) |
| InChIKey | QOFKIAAPNMMUDK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|