C8H10ClF2N3 — CID 130859928
4-chloro-1-[(3,3-difluorocyclobutyl)methyl]pyrazol-3-amine (PubChem CID 130859928) has the molecular formula C8H10ClF2N3 and a molecular weight of 221.64 g/mol. Its IUPAC name is 4-chloro-1-[(3,3-difluorocyclobutyl)methyl]pyrazol-3-amine.
| Compound Name | 4-chloro-1-[(3,3-difluorocyclobutyl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 130859928 |
| Molecular Formula | C8H10ClF2N3 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-chloro-1-[(3,3-difluorocyclobutyl)methyl]pyrazol-3-amine |
| SMILES | Nc1nn(CC2CC(F)(F)C2)cc1Cl |
| InChI | InChI=1S/C8H10ClF2N3/c9-6-4-14(13-7(6)12)3-5-1-8(10,11)2-5/h4-5H,1-3H2,(H2,12,13) |
| InChIKey | MEBKRDYNVDXXBQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |