C5H7N3O4 — CID 130863136
(3S,4R,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-one (PubChem CID 130863136) has the molecular formula C5H7N3O4 and a molecular weight of 173.13 g/mol. Its IUPAC name is (3S,4R,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3S,4R,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 130863136 |
| Molecular Formula | C5H7N3O4 |
| Molecular Weight | 173.13 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | (3S,4R,5R)-5-(azidomethyl)-3,4-dihydroxyoxolan-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H7N3O4/c6-8-7-1-2-3(9)4(10)5(11)12-2/h2-4,9-10H,1H2/t2-,3+,4+/m1/s1 |
| InChIKey | TVYMNCLFKDIJNE-UZBSEBFBSA-N |
| XLogP | -1.06 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.13 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|