C10H18FNO — CID 130863556
(3aS,7aR)-5-(3-fluoropropyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 130863556) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (3aS,7aR)-5-(3-fluoropropyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (3aS,7aR)-5-(3-fluoropropyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 130863556 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3aS,7aR)-5-(3-fluoropropyl)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | FCCCN1CC[C@H]2OCC[C@H]2C1 |
| InChI | InChI=1S/C10H18FNO/c11-4-1-5-12-6-2-10-9(8-12)3-7-13-10/h9-10H,1-8H2/t9-,10+/m0/s1 |
| InChIKey | NXVMDWLQTBFYHO-VHSXEESVSA-N |
| XLogP | 1.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |