methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate

C9H8Cl2O3 — CID 130864862

IUPACmethyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate
SMILESCOC(=O)Cc1c(O)ccc(Cl)c1Cl
InChIInChI=1S/C9H8Cl2O3/c1-14-8(13)4-5-7(12)3-2-6(10)9(5)11/h2-3,12H,4H2,1H3
InChIKeyDAOJAJAVQVQORW-UHFFFAOYSA-N
MW235.07 g/mol
LogP2.41
Rot. Bonds2

About methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate

methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate (PubChem CID 130864862) has the molecular formula C9H8Cl2O3 and a molecular weight of 235.07 g/mol. Its IUPAC name is methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate.

Molecular Properties

Compound Namemethyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate
PubChem CID130864862
Molecular FormulaC9H8Cl2O3
Molecular Weight235.07 g/mol
Exact Mass233.99
IUPAC Namemethyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate
SMILESCOC(=O)Cc1c(O)ccc(Cl)c1Cl
InChIInChI=1S/C9H8Cl2O3/c1-14-8(13)4-5-7(12)3-2-6(10)9(5)11/h2-3,12H,4H2,1H3
InChIKeyDAOJAJAVQVQORW-UHFFFAOYSA-N
XLogP2.41
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.07
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate?
The IUPAC name of methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate (CID 130864862) is methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate.
What is the SMILES notation for methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate?
The canonical SMILES for methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate is COC(=O)Cc1c(O)ccc(Cl)c1Cl.
What is the InChIKey of methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate?
The InChIKey is DAOJAJAVQVQORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O3/c1-14-8(13)4-5-7(12)3-2-6(10)9(5)11/h2-3,12H,4H2,1H3.
What are the key properties of methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate?
methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate has a molecular weight of 235.07 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,3-dichloro-6-hydroxyphenyl)acetate is sourced from PubChem (CID 130864862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).