About 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone
1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone (PubChem CID 130865684) has the molecular formula C8H12F2N2O
and a molecular weight of 190.19 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone |
| PubChem CID | 130865684 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)N1CCN2CCC1C2 |
| InChI | InChI=1S/C8H12F2N2O/c9-7(10)8(13)12-4-3-11-2-1-6(12)5-11/h6-7H,1-5H2 |
| InChIKey | GGZKNLGEMVOQLY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone (CID 130865684) is 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone is O=C(C(F)F)N1CCN2CCC1C2.
What is the InChIKey of 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone?
The InChIKey is GGZKNLGEMVOQLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O/c9-7(10)8(13)12-4-3-11-2-1-6(12)5-11/h6-7H,1-5H2.
What are the key properties of 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone?
1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone has a molecular weight of 190.19 g/mol, XLogP of 0.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-diazabicyclo[3.2.1]octan-4-yl)-2,2-difluoroethanone is sourced from PubChem (CID 130865684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).