About 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene
2-(chloromethyl)-5,6-dimethyl-1-benzothiophene (PubChem CID 130866193) has the molecular formula C11H11ClS
and a molecular weight of 210.73 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene.
Molecular Properties
| Compound Name | 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene |
| PubChem CID | 130866193 |
| Molecular Formula | C11H11ClS |
| Molecular Weight | 210.73 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene |
| SMILES | Cc1cc2cc(CCl)sc2cc1C |
| InChI | InChI=1S/C11H11ClS/c1-7-3-9-5-10(6-12)13-11(9)4-8(7)2/h3-5H,6H2,1-2H3 |
| InChIKey | AULJROLHDBOONL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene?
The IUPAC name of 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene (CID 130866193) is 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene.
What is the SMILES notation for 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene?
The canonical SMILES for 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene is Cc1cc2cc(CCl)sc2cc1C.
What is the InChIKey of 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene?
The InChIKey is AULJROLHDBOONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClS/c1-7-3-9-5-10(6-12)13-11(9)4-8(7)2/h3-5H,6H2,1-2H3.
What are the key properties of 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene?
2-(chloromethyl)-5,6-dimethyl-1-benzothiophene has a molecular weight of 210.73 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-5,6-dimethyl-1-benzothiophene is sourced from PubChem (CID 130866193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).