About 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde
2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde (PubChem CID 130867538) has the molecular formula C5H3NO3S
and a molecular weight of 157.15 g/mol. Its IUPAC name is 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde |
| PubChem CID | 130867538 |
| Molecular Formula | C5H3NO3S |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde |
| SMILES | O=Cc1[nH]c(=O)sc1C=O |
| InChI | InChI=1S/C5H3NO3S/c7-1-3-4(2-8)10-5(9)6-3/h1-2H,(H,6,9) |
| InChIKey | CVHXZDFNNRMHFF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde?
The IUPAC name of 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde (CID 130867538) is 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde.
What is the SMILES notation for 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde?
The canonical SMILES for 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde is O=Cc1[nH]c(=O)sc1C=O.
What is the InChIKey of 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde?
The InChIKey is CVHXZDFNNRMHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO3S/c7-1-3-4(2-8)10-5(9)6-3/h1-2H,(H,6,9).
What are the key properties of 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde?
2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde has a molecular weight of 157.15 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3H-1,3-thiazole-4,5-dicarbaldehyde is sourced from PubChem (CID 130867538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).