C19H28LiN2P — CID 13086799
lithium;methanidyl(diphenyl)phosphane;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 13086799) has the molecular formula C19H28LiN2P and a molecular weight of 322.36 g/mol. Its IUPAC name is lithium;methanidyl(diphenyl)phosphane;N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | lithium;methanidyl(diphenyl)phosphane;N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 13086799 |
| Molecular Formula | C19H28LiN2P |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | lithium;methanidyl(diphenyl)phosphane;N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C.[CH2-]P(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C13H12P.C6H16N2.Li/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-7(2)5-6-8(3)4;/h2-11H,1H2;5-6H2,1-4H3;/q-1;;+1 |
| InChIKey | PXCGITFHLAHOCN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|