C9H15N3 — CID 130870168
5-amino-1,2,3,3a,4,6,7,7a-octahydroisoindole-5-carbonitrile (PubChem CID 130870168) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-amino-1,2,3,3a,4,6,7,7a-octahydroisoindole-5-carbonitrile.
| Compound Name | 5-amino-1,2,3,3a,4,6,7,7a-octahydroisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 130870168 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 5-amino-1,2,3,3a,4,6,7,7a-octahydroisoindole-5-carbonitrile |
| SMILES | N#CC1(N)CCC2CNCC2C1 |
| InChI | InChI=1S/C9H15N3/c10-6-9(11)2-1-7-4-12-5-8(7)3-9/h7-8,12H,1-5,11H2 |
| InChIKey | YENXCVJEEFOJBD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |