About 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole
3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole (PubChem CID 130870172) has the molecular formula C4H4N6S
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole |
| PubChem CID | 130870172 |
| Molecular Formula | C4H4N6S |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole |
| SMILES | c1nsnc1Cc1nn[nH]n1 |
| InChI | InChI=1S/C4H4N6S/c1(3-2-5-11-8-3)4-6-9-10-7-4/h2H,1H2,(H,6,7,9,10) |
| InChIKey | USLVXSVAVTYTNF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole?
The IUPAC name of 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole (CID 130870172) is 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole.
What is the SMILES notation for 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole?
The canonical SMILES for 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole is c1nsnc1Cc1nn[nH]n1.
What is the InChIKey of 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole?
The InChIKey is USLVXSVAVTYTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N6S/c1(3-2-5-11-8-3)4-6-9-10-7-4/h2H,1H2,(H,6,7,9,10).
What are the key properties of 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole?
3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole has a molecular weight of 168.19 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-tetrazol-5-ylmethyl)-1,2,5-thiadiazole is sourced from PubChem (CID 130870172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).